C18H24N4O3 — CID 118401032
(E)-2-cyano-N-(2,3-dihydroxypropyl)-3-[4-(4-methylpiperazin-1-yl)phenyl]prop-2-enamide (PubChem CID 118401032) has the molecular formula C18H24N4O3 and a molecular weight of 344.42 g/mol. Its IUPAC name is (E)-2-cyano-N-(2,3-dihydroxypropyl)-3-[4-(4-methylpiperazin-1-yl)phenyl]prop-2-enamide.
| Compound Name | (E)-2-cyano-N-(2,3-dihydroxypropyl)-3-[4-(4-methylpiperazin-1-yl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 118401032 |
| Molecular Formula | C18H24N4O3 |
| Molecular Weight | 344.42 g/mol |
| Exact Mass | 344.18 |
| IUPAC Name | (E)-2-cyano-N-(2,3-dihydroxypropyl)-3-[4-(4-methylpiperazin-1-yl)phenyl]prop-2-enamide |
| SMILES | CN1CCN(c2ccc(/C=C(\C#N)C(=O)NCC(O)CO)cc2)CC1 |
| InChI | InChI=1S/C18H24N4O3/c1-21-6-8-22(9-7-21)16-4-2-14(3-5-16)10-15(11-19)18(25)20-12-17(24)13-23/h2-5,10,17,23-24H,6-9,12-13H2,1H3,(H,20,25)/b15-10+ |
| InChIKey | OEWGXGJPTZKRLQ-XNTDXEJSSA-N |
| XLogP | -0.19 |
| TPSA | 99.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.42 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|