C21H28N4O4 — CID 146519762
(E)-2-cyano-N-[[(2R,3S,4R)-3,4-dihydroxyoxan-2-yl]methyl]-3-[4-(4-methylpiperazin-1-yl)phenyl]prop-2-enamide (PubChem CID 146519762) has the molecular formula C21H28N4O4 and a molecular weight of 400.48 g/mol. Its IUPAC name is (E)-2-cyano-N-[[(2R,3S,4R)-3,4-dihydroxyoxan-2-yl]methyl]-3-[4-(4-methylpiperazin-1-yl)phenyl]prop-2-enamide.
| Compound Name | (E)-2-cyano-N-[[(2R,3S,4R)-3,4-dihydroxyoxan-2-yl]methyl]-3-[4-(4-methylpiperazin-1-yl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 146519762 |
| Molecular Formula | C21H28N4O4 |
| Molecular Weight | 400.48 g/mol |
| Exact Mass | 400.21 |
| IUPAC Name | (E)-2-cyano-N-[[(2R,3S,4R)-3,4-dihydroxyoxan-2-yl]methyl]-3-[4-(4-methylpiperazin-1-yl)phenyl]prop-2-enamide |
| SMILES | CN1CCN(c2ccc(/C=C(\C#N)C(=O)NC[C@H]3OCC[C@@H](O)[C@@H]3O)cc2)CC1 |
| InChI | InChI=1S/C21H28N4O4/c1-24-7-9-25(10-8-24)17-4-2-15(3-5-17)12-16(13-22)21(28)23-14-19-20(27)18(26)6-11-29-19/h2-5,12,18-20,26-27H,6-11,14H2,1H3,(H,23,28)/b16-12+/t18-,19-,20+/m1/s1 |
| InChIKey | JCKFSEFVZPOUPL-VMILJWFASA-N |
| XLogP | -0.03 |
| TPSA | 109.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.48 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|