C31H37N5O6 — CID 166874338
(E)-2-cyano-3-[1-methyl-5-[6-(4-methylpiperazin-1-yl)naphthalen-2-yl]pyrrol-2-yl]-N-[[(2R,3S,4S,5R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]methyl]prop-2-enamide (PubChem CID 166874338) has the molecular formula C31H37N5O6 and a molecular weight of 575.67 g/mol. Its IUPAC name is (E)-2-cyano-3-[1-methyl-5-[6-(4-methylpiperazin-1-yl)naphthalen-2-yl]pyrrol-2-yl]-N-[[(2R,3S,4S,5R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]methyl]prop-2-enamide.
| Compound Name | (E)-2-cyano-3-[1-methyl-5-[6-(4-methylpiperazin-1-yl)naphthalen-2-yl]pyrrol-2-yl]-N-[[(2R,3S,4S,5R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]methyl]prop-2-enamide |
|---|---|
| PubChem CID | 166874338 |
| Molecular Formula | C31H37N5O6 |
| Molecular Weight | 575.67 g/mol |
| Exact Mass | 575.27 |
| IUPAC Name | (E)-2-cyano-3-[1-methyl-5-[6-(4-methylpiperazin-1-yl)naphthalen-2-yl]pyrrol-2-yl]-N-[[(2R,3S,4S,5R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]methyl]prop-2-enamide |
| SMILES | CN1CCN(c2ccc3cc(-c4ccc(/C=C(\C#N)C(=O)NC[C@H]5OC(CO)[C@H](O)[C@@H](O)[C@@H]5O)n4C)ccc3c2)CC1 |
| InChI | InChI=1S/C31H37N5O6/c1-34-9-11-36(12-10-34)24-6-5-19-13-21(4-3-20(19)14-24)25-8-7-23(35(25)2)15-22(16-32)31(41)33-17-26-28(38)30(40)29(39)27(18-37)42-26/h3-8,13-15,26-30,37-40H,9-12,17-18H2,1-2H3,(H,33,41)/b22-15+/t26-,27?,28-,29+,30+/m1/s1 |
| InChIKey | JMMCVRRYOUSSKQ-NROQFCHNSA-N |
| XLogP | 0.46 |
| TPSA | 154.45 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.67 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|