C30H35N5O5S — CID 146519632
(E)-2-cyano-N-[[(4S,5S,6R)-4,5-dihydroxyoxathian-6-yl]methyl]-3-[1-methyl-5-[6-(2-morpholin-4-ylethylamino)naphthalen-2-yl]pyrrol-2-yl]prop-2-enamide (PubChem CID 146519632) has the molecular formula C30H35N5O5S and a molecular weight of 577.71 g/mol. Its IUPAC name is (E)-2-cyano-N-[[(4S,5S,6R)-4,5-dihydroxyoxathian-6-yl]methyl]-3-[1-methyl-5-[6-(2-morpholin-4-ylethylamino)naphthalen-2-yl]pyrrol-2-yl]prop-2-enamide.
| Compound Name | (E)-2-cyano-N-[[(4S,5S,6R)-4,5-dihydroxyoxathian-6-yl]methyl]-3-[1-methyl-5-[6-(2-morpholin-4-ylethylamino)naphthalen-2-yl]pyrrol-2-yl]prop-2-enamide |
|---|---|
| PubChem CID | 146519632 |
| Molecular Formula | C30H35N5O5S |
| Molecular Weight | 577.71 g/mol |
| Exact Mass | 577.24 |
| IUPAC Name | (E)-2-cyano-N-[[(4S,5S,6R)-4,5-dihydroxyoxathian-6-yl]methyl]-3-[1-methyl-5-[6-(2-morpholin-4-ylethylamino)naphthalen-2-yl]pyrrol-2-yl]prop-2-enamide |
| SMILES | Cn1c(/C=C(\C#N)C(=O)NC[C@H]2OSC[C@@H](O)[C@@H]2O)ccc1-c1ccc2cc(NCCN3CCOCC3)ccc2c1 |
| InChI | InChI=1S/C30H35N5O5S/c1-34-25(16-23(17-31)30(38)33-18-28-29(37)27(36)19-41-40-28)6-7-26(34)22-3-2-21-15-24(5-4-20(21)14-22)32-8-9-35-10-12-39-13-11-35/h2-7,14-16,27-29,32,36-37H,8-13,18-19H2,1H3,(H,33,38)/b23-16+/t27-,28-,29+/m1/s1 |
| InChIKey | SQUASHDOUUPUJZ-SSLDCSFSSA-N |
| XLogP | 2.38 |
| TPSA | 132.01 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.71 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|