C30H37N5O8S — CID 122683829
(E)-1-cyano-2-[1-methyl-5-[6-(2-morpholin-4-ylethylamino)naphthalen-2-yl]pyrrol-2-yl]-N-[[(3S,4S,5R)-3,4,5,6-tetrahydroxyoxan-2-yl]methyl]ethenesulfonamide (PubChem CID 122683829) has the molecular formula C30H37N5O8S and a molecular weight of 627.72 g/mol. Its IUPAC name is (E)-1-cyano-2-[1-methyl-5-[6-(2-morpholin-4-ylethylamino)naphthalen-2-yl]pyrrol-2-yl]-N-[[(3S,4S,5R)-3,4,5,6-tetrahydroxyoxan-2-yl]methyl]ethenesulfonamide.
| Compound Name | (E)-1-cyano-2-[1-methyl-5-[6-(2-morpholin-4-ylethylamino)naphthalen-2-yl]pyrrol-2-yl]-N-[[(3S,4S,5R)-3,4,5,6-tetrahydroxyoxan-2-yl]methyl]ethenesulfonamide |
|---|---|
| PubChem CID | 122683829 |
| Molecular Formula | C30H37N5O8S |
| Molecular Weight | 627.72 g/mol |
| Exact Mass | 627.24 |
| IUPAC Name | (E)-1-cyano-2-[1-methyl-5-[6-(2-morpholin-4-ylethylamino)naphthalen-2-yl]pyrrol-2-yl]-N-[[(3S,4S,5R)-3,4,5,6-tetrahydroxyoxan-2-yl]methyl]ethenesulfonamide |
| SMILES | Cn1c(/C=C(\C#N)S(=O)(=O)NCC2OC(O)[C@H](O)[C@@H](O)[C@@H]2O)ccc1-c1ccc2cc(NCCN3CCOCC3)ccc2c1 |
| InChI | InChI=1S/C30H37N5O8S/c1-34-23(16-24(17-31)44(40,41)33-18-26-27(36)28(37)29(38)30(39)43-26)6-7-25(34)21-3-2-20-15-22(5-4-19(20)14-21)32-8-9-35-10-12-42-13-11-35/h2-7,14-16,26-30,32-33,36-39H,8-13,18H2,1H3/b24-16+/t26?,27-,28+,29-,30?/m1/s1 |
| InChIKey | URDQIQMEAWPLMP-XGBFWESZSA-N |
| XLogP | 0.17 |
| TPSA | 189.54 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.72 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|