C26H30N4O6S — CID 145041450
(E)-1-cyano-2-[5-[6-(dimethylamino)naphthalen-2-yl]-1-methylpyrrol-2-yl]-N-[[(2R,3S,4R,5S)-3,4,5-trihydroxyoxan-2-yl]methyl]ethenesulfonamide (PubChem CID 145041450) has the molecular formula C26H30N4O6S and a molecular weight of 526.62 g/mol. Its IUPAC name is (E)-1-cyano-2-[5-[6-(dimethylamino)naphthalen-2-yl]-1-methylpyrrol-2-yl]-N-[[(2R,3S,4R,5S)-3,4,5-trihydroxyoxan-2-yl]methyl]ethenesulfonamide.
| Compound Name | (E)-1-cyano-2-[5-[6-(dimethylamino)naphthalen-2-yl]-1-methylpyrrol-2-yl]-N-[[(2R,3S,4R,5S)-3,4,5-trihydroxyoxan-2-yl]methyl]ethenesulfonamide |
|---|---|
| PubChem CID | 145041450 |
| Molecular Formula | C26H30N4O6S |
| Molecular Weight | 526.62 g/mol |
| Exact Mass | 526.19 |
| IUPAC Name | (E)-1-cyano-2-[5-[6-(dimethylamino)naphthalen-2-yl]-1-methylpyrrol-2-yl]-N-[[(2R,3S,4R,5S)-3,4,5-trihydroxyoxan-2-yl]methyl]ethenesulfonamide |
| SMILES | CN(C)c1ccc2cc(-c3ccc(/C=C(\C#N)S(=O)(=O)NC[C@H]4OC[C@H](O)[C@@H](O)[C@@H]4O)n3C)ccc2c1 |
| InChI | InChI=1S/C26H30N4O6S/c1-29(2)19-7-6-16-10-18(5-4-17(16)11-19)22-9-8-20(30(22)3)12-21(13-27)37(34,35)28-14-24-26(33)25(32)23(31)15-36-24/h4-12,23-26,28,31-33H,14-15H2,1-3H3/b21-12+/t23-,24+,25+,26+/m0/s1 |
| InChIKey | NYXLCOLMBWGWAV-RGTGGDACSA-N |
| XLogP | 1.18 |
| TPSA | 148.05 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.62 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|