C29H34N4O7S — CID 122682970
(E)-1-cyano-2-[1-methyl-5-(6-morpholin-4-ylnaphthalen-2-yl)pyrrol-2-yl]-N-[[(2R,3S,4R,5R)-3,4,6-trihydroxy-5-methyloxan-2-yl]methyl]ethenesulfonamide (PubChem CID 122682970) has the molecular formula C29H34N4O7S and a molecular weight of 582.68 g/mol. Its IUPAC name is (E)-1-cyano-2-[1-methyl-5-(6-morpholin-4-ylnaphthalen-2-yl)pyrrol-2-yl]-N-[[(2R,3S,4R,5R)-3,4,6-trihydroxy-5-methyloxan-2-yl]methyl]ethenesulfonamide.
| Compound Name | (E)-1-cyano-2-[1-methyl-5-(6-morpholin-4-ylnaphthalen-2-yl)pyrrol-2-yl]-N-[[(2R,3S,4R,5R)-3,4,6-trihydroxy-5-methyloxan-2-yl]methyl]ethenesulfonamide |
|---|---|
| PubChem CID | 122682970 |
| Molecular Formula | C29H34N4O7S |
| Molecular Weight | 582.68 g/mol |
| Exact Mass | 582.21 |
| IUPAC Name | (E)-1-cyano-2-[1-methyl-5-(6-morpholin-4-ylnaphthalen-2-yl)pyrrol-2-yl]-N-[[(2R,3S,4R,5R)-3,4,6-trihydroxy-5-methyloxan-2-yl]methyl]ethenesulfonamide |
| SMILES | C[C@H]1C(O)O[C@H](CNS(=O)(=O)/C(C#N)=C/c2ccc(-c3ccc4cc(N5CCOCC5)ccc4c3)n2C)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C29H34N4O7S/c1-18-27(34)28(35)26(40-29(18)36)17-31-41(37,38)24(16-30)15-22-7-8-25(32(22)2)21-4-3-20-14-23(6-5-19(20)13-21)33-9-11-39-12-10-33/h3-8,13-15,18,26-29,31,34-36H,9-12,17H2,1-2H3/b24-15+/t18-,26-,27-,28-,29?/m1/s1 |
| InChIKey | RMGDUPZUUZJPKS-PPLOQDRESA-N |
| XLogP | 1.54 |
| TPSA | 157.28 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.68 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|