C26H30N4O3S — CID 122682763
(E)-1-cyano-N-(2-methoxyethyl)-2-[1-methyl-5-(6-piperidin-1-ylnaphthalen-2-yl)pyrrol-2-yl]ethenesulfonamide (PubChem CID 122682763) has the molecular formula C26H30N4O3S and a molecular weight of 478.62 g/mol. Its IUPAC name is (E)-1-cyano-N-(2-methoxyethyl)-2-[1-methyl-5-(6-piperidin-1-ylnaphthalen-2-yl)pyrrol-2-yl]ethenesulfonamide.
| Compound Name | (E)-1-cyano-N-(2-methoxyethyl)-2-[1-methyl-5-(6-piperidin-1-ylnaphthalen-2-yl)pyrrol-2-yl]ethenesulfonamide |
|---|---|
| PubChem CID | 122682763 |
| Molecular Formula | C26H30N4O3S |
| Molecular Weight | 478.62 g/mol |
| Exact Mass | 478.20 |
| IUPAC Name | (E)-1-cyano-N-(2-methoxyethyl)-2-[1-methyl-5-(6-piperidin-1-ylnaphthalen-2-yl)pyrrol-2-yl]ethenesulfonamide |
| SMILES | COCCNS(=O)(=O)/C(C#N)=C/c1ccc(-c2ccc3cc(N4CCCCC4)ccc3c2)n1C |
| InChI | InChI=1S/C26H30N4O3S/c1-29-23(18-25(19-27)34(31,32)28-12-15-33-2)10-11-26(29)22-7-6-21-17-24(9-8-20(21)16-22)30-13-4-3-5-14-30/h6-11,16-18,28H,3-5,12-15H2,1-2H3/b25-18+ |
| InChIKey | PZVGUJHFFCCKEQ-XIEYBQDHSA-N |
| XLogP | 4.27 |
| TPSA | 87.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.62 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|