C22H28N4O3S — CID 139372590
(E)-1-cyano-N-(2-ethoxyethyl)-2-[6-(4-methylpiperazin-1-yl)naphthalen-2-yl]ethenesulfonamide (PubChem CID 139372590) has the molecular formula C22H28N4O3S and a molecular weight of 428.56 g/mol. Its IUPAC name is (E)-1-cyano-N-(2-ethoxyethyl)-2-[6-(4-methylpiperazin-1-yl)naphthalen-2-yl]ethenesulfonamide.
| Compound Name | (E)-1-cyano-N-(2-ethoxyethyl)-2-[6-(4-methylpiperazin-1-yl)naphthalen-2-yl]ethenesulfonamide |
|---|---|
| PubChem CID | 139372590 |
| Molecular Formula | C22H28N4O3S |
| Molecular Weight | 428.56 g/mol |
| Exact Mass | 428.19 |
| IUPAC Name | (E)-1-cyano-N-(2-ethoxyethyl)-2-[6-(4-methylpiperazin-1-yl)naphthalen-2-yl]ethenesulfonamide |
| SMILES | CCOCCNS(=O)(=O)/C(C#N)=C/c1ccc2cc(N3CCN(C)CC3)ccc2c1 |
| InChI | InChI=1S/C22H28N4O3S/c1-3-29-13-8-24-30(27,28)22(17-23)15-18-4-5-20-16-21(7-6-19(20)14-18)26-11-9-25(2)10-12-26/h4-7,14-16,24H,3,8-13H2,1-2H3/b22-15+ |
| InChIKey | ALVNZWZPMCTZAQ-PXLXIMEGSA-N |
| XLogP | 2.41 |
| TPSA | 85.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.56 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|