C25H28N4O5S — CID 118401170
(E)-1-cyano-N-(2,3-dihydroxypropyl)-2-[5-[6-(4-methylpiperazin-1-yl)naphthalen-2-yl]furan-2-yl]ethenesulfonamide (PubChem CID 118401170) has the molecular formula C25H28N4O5S and a molecular weight of 496.59 g/mol. Its IUPAC name is (E)-1-cyano-N-(2,3-dihydroxypropyl)-2-[5-[6-(4-methylpiperazin-1-yl)naphthalen-2-yl]furan-2-yl]ethenesulfonamide.
| Compound Name | (E)-1-cyano-N-(2,3-dihydroxypropyl)-2-[5-[6-(4-methylpiperazin-1-yl)naphthalen-2-yl]furan-2-yl]ethenesulfonamide |
|---|---|
| PubChem CID | 118401170 |
| Molecular Formula | C25H28N4O5S |
| Molecular Weight | 496.59 g/mol |
| Exact Mass | 496.18 |
| IUPAC Name | (E)-1-cyano-N-(2,3-dihydroxypropyl)-2-[5-[6-(4-methylpiperazin-1-yl)naphthalen-2-yl]furan-2-yl]ethenesulfonamide |
| SMILES | CN1CCN(c2ccc3cc(-c4ccc(/C=C(\C#N)S(=O)(=O)NCC(O)CO)o4)ccc3c2)CC1 |
| InChI | InChI=1S/C25H28N4O5S/c1-28-8-10-29(11-9-28)21-5-4-18-12-20(3-2-19(18)13-21)25-7-6-23(34-25)14-24(15-26)35(32,33)27-16-22(31)17-30/h2-7,12-14,22,27,30-31H,8-11,16-17H2,1H3/b24-14+ |
| InChIKey | IQBWYFKGZYXTKG-ZVHZXABRSA-N |
| XLogP | 1.99 |
| TPSA | 130.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.59 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|