C21H25N3O4S — CID 118949451
1-cyano-N-(2,3-dihydroxypropyl)-2-(6-piperidin-1-ylnaphthalen-2-yl)ethenesulfonamide (PubChem CID 118949451) has the molecular formula C21H25N3O4S and a molecular weight of 415.52 g/mol. Its IUPAC name is 1-cyano-N-(2,3-dihydroxypropyl)-2-(6-piperidin-1-ylnaphthalen-2-yl)ethenesulfonamide.
| Compound Name | 1-cyano-N-(2,3-dihydroxypropyl)-2-(6-piperidin-1-ylnaphthalen-2-yl)ethenesulfonamide |
|---|---|
| PubChem CID | 118949451 |
| Molecular Formula | C21H25N3O4S |
| Molecular Weight | 415.52 g/mol |
| Exact Mass | 415.16 |
| IUPAC Name | 1-cyano-N-(2,3-dihydroxypropyl)-2-(6-piperidin-1-ylnaphthalen-2-yl)ethenesulfonamide |
| SMILES | N#CC(=Cc1ccc2cc(N3CCCCC3)ccc2c1)S(=O)(=O)NCC(O)CO |
| InChI | InChI=1S/C21H25N3O4S/c22-13-21(29(27,28)23-14-20(26)15-25)11-16-4-5-18-12-19(7-6-17(18)10-16)24-8-2-1-3-9-24/h4-7,10-12,20,23,25-26H,1-3,8-9,14-15H2 |
| InChIKey | AEKHKXRZUFTQSY-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 113.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.52 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|