C18H21N3O4S — CID 123814274
1-cyano-N-(2,3-dihydroxypropyl)-2-[6-(dimethylamino)naphthalen-2-yl]ethenesulfonamide (PubChem CID 123814274) has the molecular formula C18H21N3O4S and a molecular weight of 375.45 g/mol. Its IUPAC name is 1-cyano-N-(2,3-dihydroxypropyl)-2-[6-(dimethylamino)naphthalen-2-yl]ethenesulfonamide.
| Compound Name | 1-cyano-N-(2,3-dihydroxypropyl)-2-[6-(dimethylamino)naphthalen-2-yl]ethenesulfonamide |
|---|---|
| PubChem CID | 123814274 |
| Molecular Formula | C18H21N3O4S |
| Molecular Weight | 375.45 g/mol |
| Exact Mass | 375.13 |
| IUPAC Name | 1-cyano-N-(2,3-dihydroxypropyl)-2-[6-(dimethylamino)naphthalen-2-yl]ethenesulfonamide |
| SMILES | CN(C)c1ccc2cc(C=C(C#N)S(=O)(=O)NCC(O)CO)ccc2c1 |
| InChI | InChI=1S/C18H21N3O4S/c1-21(2)16-6-5-14-7-13(3-4-15(14)9-16)8-18(10-19)26(24,25)20-11-17(23)12-22/h3-9,17,20,22-23H,11-12H2,1-2H3 |
| InChIKey | ORDFDWNPXPFXMD-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 113.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.45 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|