C22H27N3O4S — CID 118949850
(Z)-1-cyano-N-(2,3-dihydroxypropyl)-2-(6-piperidin-1-ylnaphthalen-2-yl)prop-1-ene-1-sulfonamide (PubChem CID 118949850) has the molecular formula C22H27N3O4S and a molecular weight of 429.54 g/mol. Its IUPAC name is (Z)-1-cyano-N-(2,3-dihydroxypropyl)-2-(6-piperidin-1-ylnaphthalen-2-yl)prop-1-ene-1-sulfonamide.
| Compound Name | (Z)-1-cyano-N-(2,3-dihydroxypropyl)-2-(6-piperidin-1-ylnaphthalen-2-yl)prop-1-ene-1-sulfonamide |
|---|---|
| PubChem CID | 118949850 |
| Molecular Formula | C22H27N3O4S |
| Molecular Weight | 429.54 g/mol |
| Exact Mass | 429.17 |
| IUPAC Name | (Z)-1-cyano-N-(2,3-dihydroxypropyl)-2-(6-piperidin-1-ylnaphthalen-2-yl)prop-1-ene-1-sulfonamide |
| SMILES | C/C(=C(\C#N)S(=O)(=O)NCC(O)CO)c1ccc2cc(N3CCCCC3)ccc2c1 |
| InChI | InChI=1S/C22H27N3O4S/c1-16(22(13-23)30(28,29)24-14-21(27)15-26)17-5-6-19-12-20(8-7-18(19)11-17)25-9-3-2-4-10-25/h5-8,11-12,21,24,26-27H,2-4,9-10,14-15H2,1H3/b22-16- |
| InChIKey | ACYGJNAHZYKGOT-JWGURIENSA-N |
| XLogP | 2.36 |
| TPSA | 113.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.54 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|