C27H32N4O4S — CID 122682848
(E)-1-cyano-N-(2-hydroxybutyl)-2-[5-[6-(4-methylpiperazin-1-yl)naphthalen-2-yl]furan-2-yl]prop-1-ene-1-sulfonamide (PubChem CID 122682848) has the molecular formula C27H32N4O4S and a molecular weight of 508.64 g/mol. Its IUPAC name is (E)-1-cyano-N-(2-hydroxybutyl)-2-[5-[6-(4-methylpiperazin-1-yl)naphthalen-2-yl]furan-2-yl]prop-1-ene-1-sulfonamide.
| Compound Name | (E)-1-cyano-N-(2-hydroxybutyl)-2-[5-[6-(4-methylpiperazin-1-yl)naphthalen-2-yl]furan-2-yl]prop-1-ene-1-sulfonamide |
|---|---|
| PubChem CID | 122682848 |
| Molecular Formula | C27H32N4O4S |
| Molecular Weight | 508.64 g/mol |
| Exact Mass | 508.21 |
| IUPAC Name | (E)-1-cyano-N-(2-hydroxybutyl)-2-[5-[6-(4-methylpiperazin-1-yl)naphthalen-2-yl]furan-2-yl]prop-1-ene-1-sulfonamide |
| SMILES | CCC(O)CNS(=O)(=O)/C(C#N)=C(\C)c1ccc(-c2ccc3cc(N4CCN(C)CC4)ccc3c2)o1 |
| InChI | InChI=1S/C27H32N4O4S/c1-4-24(32)18-29-36(33,34)27(17-28)19(2)25-9-10-26(35-25)22-6-5-21-16-23(8-7-20(21)15-22)31-13-11-30(3)12-14-31/h5-10,15-16,24,29,32H,4,11-14,18H2,1-3H3/b27-19+ |
| InChIKey | MDIPSIASYAKKPQ-ZXVVBBHZSA-N |
| XLogP | 3.80 |
| TPSA | 109.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.64 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|