C30H35N3O9S — CID 166874347
(E)-1-cyano-2-[5-(6-morpholin-4-ylnaphthalen-2-yl)furan-2-yl]-N-[[(2R,3S,4R,5R)-3,4,5-trihydroxy-6-(2-hydroxyethyl)oxan-2-yl]methyl]prop-1-ene-1-sulfonamide (PubChem CID 166874347) has the molecular formula C30H35N3O9S and a molecular weight of 613.69 g/mol. Its IUPAC name is (E)-1-cyano-2-[5-(6-morpholin-4-ylnaphthalen-2-yl)furan-2-yl]-N-[[(2R,3S,4R,5R)-3,4,5-trihydroxy-6-(2-hydroxyethyl)oxan-2-yl]methyl]prop-1-ene-1-sulfonamide.
| Compound Name | (E)-1-cyano-2-[5-(6-morpholin-4-ylnaphthalen-2-yl)furan-2-yl]-N-[[(2R,3S,4R,5R)-3,4,5-trihydroxy-6-(2-hydroxyethyl)oxan-2-yl]methyl]prop-1-ene-1-sulfonamide |
|---|---|
| PubChem CID | 166874347 |
| Molecular Formula | C30H35N3O9S |
| Molecular Weight | 613.69 g/mol |
| Exact Mass | 613.21 |
| IUPAC Name | (E)-1-cyano-2-[5-(6-morpholin-4-ylnaphthalen-2-yl)furan-2-yl]-N-[[(2R,3S,4R,5R)-3,4,5-trihydroxy-6-(2-hydroxyethyl)oxan-2-yl]methyl]prop-1-ene-1-sulfonamide |
| SMILES | C/C(=C(/C#N)S(=O)(=O)NC[C@H]1OC(CCO)[C@H](O)[C@@H](O)[C@@H]1O)c1ccc(-c2ccc3cc(N4CCOCC4)ccc3c2)o1 |
| InChI | InChI=1S/C30H35N3O9S/c1-18(27(16-31)43(38,39)32-17-26-29(36)30(37)28(35)25(42-26)8-11-34)23-6-7-24(41-23)21-3-2-20-15-22(5-4-19(20)14-21)33-9-12-40-13-10-33/h2-7,14-15,25-26,28-30,32,34-37H,8-13,17H2,1H3/b27-18+/t25?,26-,28+,29-,30-/m1/s1 |
| InChIKey | ZYWTZILQCNWFLR-TUWNVSNMSA-N |
| XLogP | 1.34 |
| TPSA | 185.72 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.69 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|