C30H36N4O7S — CID 122683971
(E)-1-cyano-2-[1-methyl-5-(6-piperidin-1-ylnaphthalen-2-yl)pyrrol-2-yl]-N-[[(2R,3S,4S,5R)-3,4,5,6-tetrahydroxyoxan-2-yl]methyl]prop-1-ene-1-sulfonamide (PubChem CID 122683971) has the molecular formula C30H36N4O7S and a molecular weight of 596.71 g/mol. Its IUPAC name is (E)-1-cyano-2-[1-methyl-5-(6-piperidin-1-ylnaphthalen-2-yl)pyrrol-2-yl]-N-[[(2R,3S,4S,5R)-3,4,5,6-tetrahydroxyoxan-2-yl]methyl]prop-1-ene-1-sulfonamide.
| Compound Name | (E)-1-cyano-2-[1-methyl-5-(6-piperidin-1-ylnaphthalen-2-yl)pyrrol-2-yl]-N-[[(2R,3S,4S,5R)-3,4,5,6-tetrahydroxyoxan-2-yl]methyl]prop-1-ene-1-sulfonamide |
|---|---|
| PubChem CID | 122683971 |
| Molecular Formula | C30H36N4O7S |
| Molecular Weight | 596.71 g/mol |
| Exact Mass | 596.23 |
| IUPAC Name | (E)-1-cyano-2-[1-methyl-5-(6-piperidin-1-ylnaphthalen-2-yl)pyrrol-2-yl]-N-[[(2R,3S,4S,5R)-3,4,5,6-tetrahydroxyoxan-2-yl]methyl]prop-1-ene-1-sulfonamide |
| SMILES | C/C(=C(/C#N)S(=O)(=O)NC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O)c1ccc(-c2ccc3cc(N4CCCCC4)ccc3c2)n1C |
| InChI | InChI=1S/C30H36N4O7S/c1-18(26(16-31)42(39,40)32-17-25-27(35)28(36)29(37)30(38)41-25)23-10-11-24(33(23)2)21-7-6-20-15-22(9-8-19(20)14-21)34-12-4-3-5-13-34/h6-11,14-15,25,27-30,32,35-38H,3-5,12-13,17H2,1-2H3/b26-18+/t25-,27-,28+,29-,30?/m1/s1 |
| InChIKey | BWCUEVGOABPMFX-CMDZKQEISA-N |
| XLogP | 1.81 |
| TPSA | 168.28 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.71 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|