C30H36N4O3S — CID 144928236
(E)-2-[(4,6-dihydroxyoxan-2-yl)methylamino]sulfanyl-3-[1-methyl-5-(6-piperidin-1-ylnaphthalen-2-yl)pyrrol-2-yl]but-2-enenitrile (PubChem CID 144928236) has the molecular formula C30H36N4O3S and a molecular weight of 532.71 g/mol. Its IUPAC name is (E)-2-[(4,6-dihydroxyoxan-2-yl)methylamino]sulfanyl-3-[1-methyl-5-(6-piperidin-1-ylnaphthalen-2-yl)pyrrol-2-yl]but-2-enenitrile.
| Compound Name | (E)-2-[(4,6-dihydroxyoxan-2-yl)methylamino]sulfanyl-3-[1-methyl-5-(6-piperidin-1-ylnaphthalen-2-yl)pyrrol-2-yl]but-2-enenitrile |
|---|---|
| PubChem CID | 144928236 |
| Molecular Formula | C30H36N4O3S |
| Molecular Weight | 532.71 g/mol |
| Exact Mass | 532.25 |
| IUPAC Name | (E)-2-[(4,6-dihydroxyoxan-2-yl)methylamino]sulfanyl-3-[1-methyl-5-(6-piperidin-1-ylnaphthalen-2-yl)pyrrol-2-yl]but-2-enenitrile |
| SMILES | C/C(=C(/C#N)SNCC1CC(O)CC(O)O1)c1ccc(-c2ccc3cc(N4CCCCC4)ccc3c2)n1C |
| InChI | InChI=1S/C30H36N4O3S/c1-20(29(18-31)38-32-19-26-16-25(35)17-30(36)37-26)27-10-11-28(33(27)2)23-7-6-22-15-24(9-8-21(22)14-23)34-12-4-3-5-13-34/h6-11,14-15,25-26,30,32,35-36H,3-5,12-13,16-17,19H2,1-2H3/b29-20+ |
| InChIKey | HIMBEFAIMCZHKY-ZTKZIYFRSA-N |
| XLogP | 5.19 |
| TPSA | 93.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.71 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|