C24H29N3O3S — CID 145041347
(E)-2-[(2,5-dihydroxyoxan-3-yl)amino]sulfanyl-3-(6-piperidin-1-ylnaphthalen-2-yl)but-2-enenitrile (PubChem CID 145041347) has the molecular formula C24H29N3O3S and a molecular weight of 439.58 g/mol. Its IUPAC name is (E)-2-[(2,5-dihydroxyoxan-3-yl)amino]sulfanyl-3-(6-piperidin-1-ylnaphthalen-2-yl)but-2-enenitrile.
| Compound Name | (E)-2-[(2,5-dihydroxyoxan-3-yl)amino]sulfanyl-3-(6-piperidin-1-ylnaphthalen-2-yl)but-2-enenitrile |
|---|---|
| PubChem CID | 145041347 |
| Molecular Formula | C24H29N3O3S |
| Molecular Weight | 439.58 g/mol |
| Exact Mass | 439.19 |
| IUPAC Name | (E)-2-[(2,5-dihydroxyoxan-3-yl)amino]sulfanyl-3-(6-piperidin-1-ylnaphthalen-2-yl)but-2-enenitrile |
| SMILES | C/C(=C(/C#N)SNC1CC(O)COC1O)c1ccc2cc(N3CCCCC3)ccc2c1 |
| InChI | InChI=1S/C24H29N3O3S/c1-16(23(14-25)31-26-22-13-21(28)15-30-24(22)29)17-5-6-19-12-20(8-7-18(19)11-17)27-9-3-2-4-10-27/h5-8,11-12,21-22,24,26,28-29H,2-4,9-10,13,15H2,1H3/b23-16+ |
| InChIKey | KGQFOLZAQZLTPD-XQNSMLJCSA-N |
| XLogP | 3.79 |
| TPSA | 88.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.58 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|