C28H38N4O3 — CID 166868811
(E)-2-cyano-N'-[(4-methoxy-2-methylbutan-2-yl)oxymethyl]-N'-methyl-3-(6-piperidin-1-ylnaphthalen-2-yl)but-2-enehydrazide (PubChem CID 166868811) has the molecular formula C28H38N4O3 and a molecular weight of 478.64 g/mol. Its IUPAC name is (E)-2-cyano-N'-[(4-methoxy-2-methylbutan-2-yl)oxymethyl]-N'-methyl-3-(6-piperidin-1-ylnaphthalen-2-yl)but-2-enehydrazide.
| Compound Name | (E)-2-cyano-N'-[(4-methoxy-2-methylbutan-2-yl)oxymethyl]-N'-methyl-3-(6-piperidin-1-ylnaphthalen-2-yl)but-2-enehydrazide |
|---|---|
| PubChem CID | 166868811 |
| Molecular Formula | C28H38N4O3 |
| Molecular Weight | 478.64 g/mol |
| Exact Mass | 478.29 |
| IUPAC Name | (E)-2-cyano-N'-[(4-methoxy-2-methylbutan-2-yl)oxymethyl]-N'-methyl-3-(6-piperidin-1-ylnaphthalen-2-yl)but-2-enehydrazide |
| SMILES | COCCC(C)(C)OCN(C)NC(=O)/C(C#N)=C(\C)c1ccc2cc(N3CCCCC3)ccc2c1 |
| InChI | InChI=1S/C28H38N4O3/c1-21(26(19-29)27(33)30-31(4)20-35-28(2,3)13-16-34-5)22-9-10-24-18-25(12-11-23(24)17-22)32-14-7-6-8-15-32/h9-12,17-18H,6-8,13-16,20H2,1-5H3,(H,30,33)/b26-21+ |
| InChIKey | PNYQORVMXYMPPM-YYADALCUSA-N |
| XLogP | 4.88 |
| TPSA | 77.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.64 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|