C32H41N3O3S — CID 145041247
(E)-2-cyano-N-(4-hydroxy-2-methylbutan-2-yl)-3-[5-(6-morpholin-4-ylnaphthalen-2-yl)thiophen-2-yl]but-2-enamide;2-methylpropane (PubChem CID 145041247) has the molecular formula C32H41N3O3S and a molecular weight of 547.77 g/mol. Its IUPAC name is (E)-2-cyano-N-(4-hydroxy-2-methylbutan-2-yl)-3-[5-(6-morpholin-4-ylnaphthalen-2-yl)thiophen-2-yl]but-2-enamide;2-methylpropane.
| Compound Name | (E)-2-cyano-N-(4-hydroxy-2-methylbutan-2-yl)-3-[5-(6-morpholin-4-ylnaphthalen-2-yl)thiophen-2-yl]but-2-enamide;2-methylpropane |
|---|---|
| PubChem CID | 145041247 |
| Molecular Formula | C32H41N3O3S |
| Molecular Weight | 547.77 g/mol |
| Exact Mass | 547.29 |
| IUPAC Name | (E)-2-cyano-N-(4-hydroxy-2-methylbutan-2-yl)-3-[5-(6-morpholin-4-ylnaphthalen-2-yl)thiophen-2-yl]but-2-enamide;2-methylpropane |
| SMILES | C/C(=C(/C#N)C(=O)NC(C)(C)CCO)c1ccc(-c2ccc3cc(N4CCOCC4)ccc3c2)s1.CC(C)C |
| InChI | InChI=1S/C28H31N3O3S.C4H10/c1-19(24(18-29)27(33)30-28(2,3)10-13-32)25-8-9-26(35-25)22-5-4-21-17-23(7-6-20(21)16-22)31-11-14-34-15-12-31;1-4(2)3/h4-9,16-17,32H,10-15H2,1-3H3,(H,30,33);4H,1-3H3/b24-19+; |
| InChIKey | ILIZAZLQRXNMSF-UUWMJBOLSA-N |
| XLogP | 6.64 |
| TPSA | 85.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.77 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|