C29H31N3O7S — CID 122683857
(E)-2-cyano-3-[5-(6-morpholin-4-ylnaphthalen-2-yl)thiophen-2-yl]-N-[(3R,4R,5S,6R)-2,4,5-trihydroxy-6-(hydroxymethyl)oxan-3-yl]but-2-enamide (PubChem CID 122683857) has the molecular formula C29H31N3O7S and a molecular weight of 565.65 g/mol. Its IUPAC name is (E)-2-cyano-3-[5-(6-morpholin-4-ylnaphthalen-2-yl)thiophen-2-yl]-N-[(3R,4R,5S,6R)-2,4,5-trihydroxy-6-(hydroxymethyl)oxan-3-yl]but-2-enamide.
| Compound Name | (E)-2-cyano-3-[5-(6-morpholin-4-ylnaphthalen-2-yl)thiophen-2-yl]-N-[(3R,4R,5S,6R)-2,4,5-trihydroxy-6-(hydroxymethyl)oxan-3-yl]but-2-enamide |
|---|---|
| PubChem CID | 122683857 |
| Molecular Formula | C29H31N3O7S |
| Molecular Weight | 565.65 g/mol |
| Exact Mass | 565.19 |
| IUPAC Name | (E)-2-cyano-3-[5-(6-morpholin-4-ylnaphthalen-2-yl)thiophen-2-yl]-N-[(3R,4R,5S,6R)-2,4,5-trihydroxy-6-(hydroxymethyl)oxan-3-yl]but-2-enamide |
| SMILES | C/C(=C(/C#N)C(=O)N[C@H]1C(O)O[C@H](CO)[C@@H](O)[C@@H]1O)c1ccc(-c2ccc3cc(N4CCOCC4)ccc3c2)s1 |
| InChI | InChI=1S/C29H31N3O7S/c1-16(21(14-30)28(36)31-25-27(35)26(34)22(15-33)39-29(25)37)23-6-7-24(40-23)19-3-2-18-13-20(5-4-17(18)12-19)32-8-10-38-11-9-32/h2-7,12-13,22,25-27,29,33-35,37H,8-11,15H2,1H3,(H,31,36)/b21-16+/t22-,25-,26-,27-,29?/m1/s1 |
| InChIKey | XTBVFPXSHAXZHG-CSBTZLFHSA-N |
| XLogP | 1.62 |
| TPSA | 155.51 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.65 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|