C30H36N4O3S — CID 145041326
(E)-2-cyano-N-(4-hydroxy-2-methylbutan-2-yl)-3-[5-[6-(2-morpholin-4-ylethylamino)naphthalen-2-yl]thiophen-2-yl]but-2-enamide (PubChem CID 145041326) has the molecular formula C30H36N4O3S and a molecular weight of 532.71 g/mol. Its IUPAC name is (E)-2-cyano-N-(4-hydroxy-2-methylbutan-2-yl)-3-[5-[6-(2-morpholin-4-ylethylamino)naphthalen-2-yl]thiophen-2-yl]but-2-enamide.
| Compound Name | (E)-2-cyano-N-(4-hydroxy-2-methylbutan-2-yl)-3-[5-[6-(2-morpholin-4-ylethylamino)naphthalen-2-yl]thiophen-2-yl]but-2-enamide |
|---|---|
| PubChem CID | 145041326 |
| Molecular Formula | C30H36N4O3S |
| Molecular Weight | 532.71 g/mol |
| Exact Mass | 532.25 |
| IUPAC Name | (E)-2-cyano-N-(4-hydroxy-2-methylbutan-2-yl)-3-[5-[6-(2-morpholin-4-ylethylamino)naphthalen-2-yl]thiophen-2-yl]but-2-enamide |
| SMILES | C/C(=C(/C#N)C(=O)NC(C)(C)CCO)c1ccc(-c2ccc3cc(NCCN4CCOCC4)ccc3c2)s1 |
| InChI | InChI=1S/C30H36N4O3S/c1-21(26(20-31)29(36)33-30(2,3)10-15-35)27-8-9-28(38-27)24-5-4-23-19-25(7-6-22(23)18-24)32-11-12-34-13-16-37-17-14-34/h4-9,18-19,32,35H,10-17H2,1-3H3,(H,33,36)/b26-21+ |
| InChIKey | FNBQEVBVHOPAIS-YYADALCUSA-N |
| XLogP | 4.89 |
| TPSA | 97.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.71 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|