C20H28N4O3 — CID 144927766
(E)-2-cyano-N-(1-hydroxy-2-methylpropan-2-yl)-3-[4-(2-morpholin-4-ylethylamino)phenyl]prop-2-enamide (PubChem CID 144927766) has the molecular formula C20H28N4O3 and a molecular weight of 372.47 g/mol. Its IUPAC name is (E)-2-cyano-N-(1-hydroxy-2-methylpropan-2-yl)-3-[4-(2-morpholin-4-ylethylamino)phenyl]prop-2-enamide.
| Compound Name | (E)-2-cyano-N-(1-hydroxy-2-methylpropan-2-yl)-3-[4-(2-morpholin-4-ylethylamino)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 144927766 |
| Molecular Formula | C20H28N4O3 |
| Molecular Weight | 372.47 g/mol |
| Exact Mass | 372.22 |
| IUPAC Name | (E)-2-cyano-N-(1-hydroxy-2-methylpropan-2-yl)-3-[4-(2-morpholin-4-ylethylamino)phenyl]prop-2-enamide |
| SMILES | CC(C)(CO)NC(=O)/C(C#N)=C/c1ccc(NCCN2CCOCC2)cc1 |
| InChI | InChI=1S/C20H28N4O3/c1-20(2,15-25)23-19(26)17(14-21)13-16-3-5-18(6-4-16)22-7-8-24-9-11-27-12-10-24/h3-6,13,22,25H,7-12,15H2,1-2H3,(H,23,26)/b17-13+ |
| InChIKey | KCNLRWJAKIUAFX-GHRIWEEISA-N |
| XLogP | 1.22 |
| TPSA | 97.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.47 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|