C26H40N4O3 — CID 123571313
2-cyano-N-[3-methyl-1-[(2-methylpropan-2-yl)oxy]pentan-3-yl]-3-[4-(2-morpholin-4-ylethylamino)phenyl]prop-2-enamide (PubChem CID 123571313) has the molecular formula C26H40N4O3 and a molecular weight of 456.63 g/mol. Its IUPAC name is 2-cyano-N-[3-methyl-1-[(2-methylpropan-2-yl)oxy]pentan-3-yl]-3-[4-(2-morpholin-4-ylethylamino)phenyl]prop-2-enamide.
| Compound Name | 2-cyano-N-[3-methyl-1-[(2-methylpropan-2-yl)oxy]pentan-3-yl]-3-[4-(2-morpholin-4-ylethylamino)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 123571313 |
| Molecular Formula | C26H40N4O3 |
| Molecular Weight | 456.63 g/mol |
| Exact Mass | 456.31 |
| IUPAC Name | 2-cyano-N-[3-methyl-1-[(2-methylpropan-2-yl)oxy]pentan-3-yl]-3-[4-(2-morpholin-4-ylethylamino)phenyl]prop-2-enamide |
| SMILES | CCC(C)(CCOC(C)(C)C)NC(=O)C(C#N)=Cc1ccc(NCCN2CCOCC2)cc1 |
| InChI | InChI=1S/C26H40N4O3/c1-6-26(5,11-16-33-25(2,3)4)29-24(31)22(20-27)19-21-7-9-23(10-8-21)28-12-13-30-14-17-32-18-15-30/h7-10,19,28H,6,11-18H2,1-5H3,(H,29,31) |
| InChIKey | OUIOGVZAGPHGTO-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 86.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.63 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|