C26H32N4O7 — CID 122683993
(E)-2-cyano-3-[6-(2-morpholin-4-ylethylamino)naphthalen-2-yl]-N-[[(2R,3S,4S,5R)-3,4,5,6-tetrahydroxyoxan-2-yl]methyl]prop-2-enamide (PubChem CID 122683993) has the molecular formula C26H32N4O7 and a molecular weight of 512.56 g/mol. Its IUPAC name is (E)-2-cyano-3-[6-(2-morpholin-4-ylethylamino)naphthalen-2-yl]-N-[[(2R,3S,4S,5R)-3,4,5,6-tetrahydroxyoxan-2-yl]methyl]prop-2-enamide.
| Compound Name | (E)-2-cyano-3-[6-(2-morpholin-4-ylethylamino)naphthalen-2-yl]-N-[[(2R,3S,4S,5R)-3,4,5,6-tetrahydroxyoxan-2-yl]methyl]prop-2-enamide |
|---|---|
| PubChem CID | 122683993 |
| Molecular Formula | C26H32N4O7 |
| Molecular Weight | 512.56 g/mol |
| Exact Mass | 512.23 |
| IUPAC Name | (E)-2-cyano-3-[6-(2-morpholin-4-ylethylamino)naphthalen-2-yl]-N-[[(2R,3S,4S,5R)-3,4,5,6-tetrahydroxyoxan-2-yl]methyl]prop-2-enamide |
| SMILES | N#C/C(=C\c1ccc2cc(NCCN3CCOCC3)ccc2c1)C(=O)NC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C26H32N4O7/c27-14-19(25(34)29-15-21-22(31)23(32)24(33)26(35)37-21)12-16-1-2-18-13-20(4-3-17(18)11-16)28-5-6-30-7-9-36-10-8-30/h1-4,11-13,21-24,26,28,31-33,35H,5-10,15H2,(H,29,34)/b19-12+/t21-,22-,23+,24-,26?/m1/s1 |
| InChIKey | OGOHTFWZVKAVSW-WRTVRIIDSA-N |
| XLogP | -0.59 |
| TPSA | 167.54 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.56 |
| LogP ≤ 5 | -0.59 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|