C24H27N3O5 — CID 144928034
(E)-2-cyano-N-[(4,6-dihydroxyoxan-2-yl)methyl]-3-(6-morpholin-4-ylnaphthalen-2-yl)prop-2-enamide (PubChem CID 144928034) has the molecular formula C24H27N3O5 and a molecular weight of 437.50 g/mol. Its IUPAC name is (E)-2-cyano-N-[(4,6-dihydroxyoxan-2-yl)methyl]-3-(6-morpholin-4-ylnaphthalen-2-yl)prop-2-enamide.
| Compound Name | (E)-2-cyano-N-[(4,6-dihydroxyoxan-2-yl)methyl]-3-(6-morpholin-4-ylnaphthalen-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 144928034 |
| Molecular Formula | C24H27N3O5 |
| Molecular Weight | 437.50 g/mol |
| Exact Mass | 437.20 |
| IUPAC Name | (E)-2-cyano-N-[(4,6-dihydroxyoxan-2-yl)methyl]-3-(6-morpholin-4-ylnaphthalen-2-yl)prop-2-enamide |
| SMILES | N#C/C(=C\c1ccc2cc(N3CCOCC3)ccc2c1)C(=O)NCC1CC(O)CC(O)O1 |
| InChI | InChI=1S/C24H27N3O5/c25-14-19(24(30)26-15-22-12-21(28)13-23(29)32-22)10-16-1-2-18-11-20(4-3-17(18)9-16)27-5-7-31-8-6-27/h1-4,9-11,21-23,28-29H,5-8,12-13,15H2,(H,26,30)/b19-10+ |
| InChIKey | UGSFZLLMWFMJOG-VXLYETTFSA-N |
| XLogP | 1.56 |
| TPSA | 115.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.50 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|