C26H33N3O4 — CID 144927868
(E)-2-cyano-N-[(4,6-dihydroxyoxan-2-yl)methyl]-3-[6-(dipropylamino)naphthalen-2-yl]prop-2-enamide (PubChem CID 144927868) has the molecular formula C26H33N3O4 and a molecular weight of 451.57 g/mol. Its IUPAC name is (E)-2-cyano-N-[(4,6-dihydroxyoxan-2-yl)methyl]-3-[6-(dipropylamino)naphthalen-2-yl]prop-2-enamide.
| Compound Name | (E)-2-cyano-N-[(4,6-dihydroxyoxan-2-yl)methyl]-3-[6-(dipropylamino)naphthalen-2-yl]prop-2-enamide |
|---|---|
| PubChem CID | 144927868 |
| Molecular Formula | C26H33N3O4 |
| Molecular Weight | 451.57 g/mol |
| Exact Mass | 451.25 |
| IUPAC Name | (E)-2-cyano-N-[(4,6-dihydroxyoxan-2-yl)methyl]-3-[6-(dipropylamino)naphthalen-2-yl]prop-2-enamide |
| SMILES | CCCN(CCC)c1ccc2cc(/C=C(\C#N)C(=O)NCC3CC(O)CC(O)O3)ccc2c1 |
| InChI | InChI=1S/C26H33N3O4/c1-3-9-29(10-4-2)22-8-7-19-11-18(5-6-20(19)13-22)12-21(16-27)26(32)28-17-24-14-23(30)15-25(31)33-24/h5-8,11-13,23-25,30-31H,3-4,9-10,14-15,17H2,1-2H3,(H,28,32)/b21-12+ |
| InChIKey | FJSSDHLHYGDUAD-CIAFOILYSA-N |
| XLogP | 3.35 |
| TPSA | 105.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.57 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|