C25H31N3O5 — CID 122682661
(E)-2-cyano-3-[6-(diethylamino)naphthalen-2-yl]-N-[(3R,4R,5S,6R)-6-ethyl-2,4,5-trihydroxyoxan-3-yl]prop-2-enamide (PubChem CID 122682661) has the molecular formula C25H31N3O5 and a molecular weight of 453.54 g/mol. Its IUPAC name is (E)-2-cyano-3-[6-(diethylamino)naphthalen-2-yl]-N-[(3R,4R,5S,6R)-6-ethyl-2,4,5-trihydroxyoxan-3-yl]prop-2-enamide.
| Compound Name | (E)-2-cyano-3-[6-(diethylamino)naphthalen-2-yl]-N-[(3R,4R,5S,6R)-6-ethyl-2,4,5-trihydroxyoxan-3-yl]prop-2-enamide |
|---|---|
| PubChem CID | 122682661 |
| Molecular Formula | C25H31N3O5 |
| Molecular Weight | 453.54 g/mol |
| Exact Mass | 453.23 |
| IUPAC Name | (E)-2-cyano-3-[6-(diethylamino)naphthalen-2-yl]-N-[(3R,4R,5S,6R)-6-ethyl-2,4,5-trihydroxyoxan-3-yl]prop-2-enamide |
| SMILES | CC[C@H]1OC(O)[C@H](NC(=O)/C(C#N)=C/c2ccc3cc(N(CC)CC)ccc3c2)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C25H31N3O5/c1-4-20-22(29)23(30)21(25(32)33-20)27-24(31)18(14-26)12-15-7-8-17-13-19(28(5-2)6-3)10-9-16(17)11-15/h7-13,20-23,25,29-30,32H,4-6H2,1-3H3,(H,27,31)/b18-12+/t20-,21-,22-,23-,25?/m1/s1 |
| InChIKey | AUSIQBGXYQBWRR-XDLMKMENSA-N |
| XLogP | 1.93 |
| TPSA | 126.05 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.54 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|