C19H27N3O7S — CID 123648482
1-cyano-2-[4-(diethylamino)phenyl]-N-[2,4,5-trihydroxy-6-(hydroxymethyl)oxan-3-yl]ethenesulfonamide (PubChem CID 123648482) has the molecular formula C19H27N3O7S and a molecular weight of 441.51 g/mol. Its IUPAC name is 1-cyano-2-[4-(diethylamino)phenyl]-N-[2,4,5-trihydroxy-6-(hydroxymethyl)oxan-3-yl]ethenesulfonamide.
| Compound Name | 1-cyano-2-[4-(diethylamino)phenyl]-N-[2,4,5-trihydroxy-6-(hydroxymethyl)oxan-3-yl]ethenesulfonamide |
|---|---|
| PubChem CID | 123648482 |
| Molecular Formula | C19H27N3O7S |
| Molecular Weight | 441.51 g/mol |
| Exact Mass | 441.16 |
| IUPAC Name | 1-cyano-2-[4-(diethylamino)phenyl]-N-[2,4,5-trihydroxy-6-(hydroxymethyl)oxan-3-yl]ethenesulfonamide |
| SMILES | CCN(CC)c1ccc(C=C(C#N)S(=O)(=O)NC2C(O)OC(CO)C(O)C2O)cc1 |
| InChI | InChI=1S/C19H27N3O7S/c1-3-22(4-2)13-7-5-12(6-8-13)9-14(10-20)30(27,28)21-16-18(25)17(24)15(11-23)29-19(16)26/h5-9,15-19,21,23-26H,3-4,11H2,1-2H3 |
| InChIKey | GRGMUZURFARAOY-UHFFFAOYSA-N |
| XLogP | -0.88 |
| TPSA | 163.35 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.51 |
| LogP ≤ 5 | -0.88 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|