C27H31N3O8S — CID 122684017
(E)-1-cyano-2-[5-[6-(diethylamino)naphthalen-2-yl]furan-2-yl]-N-[(3R,4R,5S,6R)-2,4,5-trihydroxy-6-(hydroxymethyl)oxan-3-yl]ethenesulfonamide (PubChem CID 122684017) has the molecular formula C27H31N3O8S and a molecular weight of 557.63 g/mol. Its IUPAC name is (E)-1-cyano-2-[5-[6-(diethylamino)naphthalen-2-yl]furan-2-yl]-N-[(3R,4R,5S,6R)-2,4,5-trihydroxy-6-(hydroxymethyl)oxan-3-yl]ethenesulfonamide.
| Compound Name | (E)-1-cyano-2-[5-[6-(diethylamino)naphthalen-2-yl]furan-2-yl]-N-[(3R,4R,5S,6R)-2,4,5-trihydroxy-6-(hydroxymethyl)oxan-3-yl]ethenesulfonamide |
|---|---|
| PubChem CID | 122684017 |
| Molecular Formula | C27H31N3O8S |
| Molecular Weight | 557.63 g/mol |
| Exact Mass | 557.18 |
| IUPAC Name | (E)-1-cyano-2-[5-[6-(diethylamino)naphthalen-2-yl]furan-2-yl]-N-[(3R,4R,5S,6R)-2,4,5-trihydroxy-6-(hydroxymethyl)oxan-3-yl]ethenesulfonamide |
| SMILES | CCN(CC)c1ccc2cc(-c3ccc(/C=C(\C#N)S(=O)(=O)N[C@H]4C(O)O[C@H](CO)[C@@H](O)[C@@H]4O)o3)ccc2c1 |
| InChI | InChI=1S/C27H31N3O8S/c1-3-30(4-2)19-8-7-16-11-18(6-5-17(16)12-19)22-10-9-20(37-22)13-21(14-28)39(35,36)29-24-26(33)25(32)23(15-31)38-27(24)34/h5-13,23-27,29,31-34H,3-4,15H2,1-2H3/b21-13+/t23-,24-,25-,26-,27?/m1/s1 |
| InChIKey | FEJAGYRBVKJPOX-XYIXNBLJSA-N |
| XLogP | 1.53 |
| TPSA | 176.49 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.63 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|