C25H33N3O6S — CID 166874188
(E)-1-cyano-N-[(3S,4R,5S,6R)-4,5-dihydroxy-6-(hydroxymethyl)oxan-3-yl]-2-[6-(dipropylamino)naphthalen-2-yl]ethenesulfonamide (PubChem CID 166874188) has the molecular formula C25H33N3O6S and a molecular weight of 503.62 g/mol. Its IUPAC name is (E)-1-cyano-N-[(3S,4R,5S,6R)-4,5-dihydroxy-6-(hydroxymethyl)oxan-3-yl]-2-[6-(dipropylamino)naphthalen-2-yl]ethenesulfonamide.
| Compound Name | (E)-1-cyano-N-[(3S,4R,5S,6R)-4,5-dihydroxy-6-(hydroxymethyl)oxan-3-yl]-2-[6-(dipropylamino)naphthalen-2-yl]ethenesulfonamide |
|---|---|
| PubChem CID | 166874188 |
| Molecular Formula | C25H33N3O6S |
| Molecular Weight | 503.62 g/mol |
| Exact Mass | 503.21 |
| IUPAC Name | (E)-1-cyano-N-[(3S,4R,5S,6R)-4,5-dihydroxy-6-(hydroxymethyl)oxan-3-yl]-2-[6-(dipropylamino)naphthalen-2-yl]ethenesulfonamide |
| SMILES | CCCN(CCC)c1ccc2cc(/C=C(\C#N)S(=O)(=O)N[C@H]3CO[C@H](CO)[C@@H](O)[C@@H]3O)ccc2c1 |
| InChI | InChI=1S/C25H33N3O6S/c1-3-9-28(10-4-2)20-8-7-18-11-17(5-6-19(18)13-20)12-21(14-26)35(32,33)27-22-16-34-23(15-29)25(31)24(22)30/h5-8,11-13,22-25,27,29-31H,3-4,9-10,15-16H2,1-2H3/b21-12+/t22-,23+,24+,25+/m0/s1 |
| InChIKey | WGHFMNNZOOAEKB-HKFAULQJSA-N |
| XLogP | 1.73 |
| TPSA | 143.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.62 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|