C20H25N3O3S — CID 122682465
(E)-1-cyano-2-[6-(diethylamino)naphthalen-2-yl]-N-(2-methoxyethyl)ethenesulfonamide (PubChem CID 122682465) has the molecular formula C20H25N3O3S and a molecular weight of 387.51 g/mol. Its IUPAC name is (E)-1-cyano-2-[6-(diethylamino)naphthalen-2-yl]-N-(2-methoxyethyl)ethenesulfonamide.
| Compound Name | (E)-1-cyano-2-[6-(diethylamino)naphthalen-2-yl]-N-(2-methoxyethyl)ethenesulfonamide |
|---|---|
| PubChem CID | 122682465 |
| Molecular Formula | C20H25N3O3S |
| Molecular Weight | 387.51 g/mol |
| Exact Mass | 387.16 |
| IUPAC Name | (E)-1-cyano-2-[6-(diethylamino)naphthalen-2-yl]-N-(2-methoxyethyl)ethenesulfonamide |
| SMILES | CCN(CC)c1ccc2cc(/C=C(\C#N)S(=O)(=O)NCCOC)ccc2c1 |
| InChI | InChI=1S/C20H25N3O3S/c1-4-23(5-2)19-9-8-17-12-16(6-7-18(17)14-19)13-20(15-21)27(24,25)22-10-11-26-3/h6-9,12-14,22H,4-5,10-11H2,1-3H3/b20-13+ |
| InChIKey | PPXXDRSVKLMDON-DEDYPNTBSA-N |
| XLogP | 3.12 |
| TPSA | 82.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.51 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|