C19H29N3O3S — CID 158433107
(E)-1-cyano-2-[4-(dipropylamino)phenyl]-N-(3-hydroxy-2-methylpropyl)ethenesulfonamide (PubChem CID 158433107) has the molecular formula C19H29N3O3S and a molecular weight of 379.53 g/mol. Its IUPAC name is (E)-1-cyano-2-[4-(dipropylamino)phenyl]-N-(3-hydroxy-2-methylpropyl)ethenesulfonamide.
| Compound Name | (E)-1-cyano-2-[4-(dipropylamino)phenyl]-N-(3-hydroxy-2-methylpropyl)ethenesulfonamide |
|---|---|
| PubChem CID | 158433107 |
| Molecular Formula | C19H29N3O3S |
| Molecular Weight | 379.53 g/mol |
| Exact Mass | 379.19 |
| IUPAC Name | (E)-1-cyano-2-[4-(dipropylamino)phenyl]-N-(3-hydroxy-2-methylpropyl)ethenesulfonamide |
| SMILES | CCCN(CCC)c1ccc(/C=C(\C#N)S(=O)(=O)NCC(C)CO)cc1 |
| InChI | InChI=1S/C19H29N3O3S/c1-4-10-22(11-5-2)18-8-6-17(7-9-18)12-19(13-20)26(24,25)21-14-16(3)15-23/h6-9,12,16,21,23H,4-5,10-11,14-15H2,1-3H3/b19-12+ |
| InChIKey | OFKRGUTYAXOIQC-XDHOZWIPSA-N |
| XLogP | 2.73 |
| TPSA | 93.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.53 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|