C15H21N3S — CID 145041393
(E)-2-aminosulfanyl-3-[4-(dipropylamino)phenyl]prop-2-enenitrile (PubChem CID 145041393) has the molecular formula C15H21N3S and a molecular weight of 275.42 g/mol. Its IUPAC name is (E)-2-aminosulfanyl-3-[4-(dipropylamino)phenyl]prop-2-enenitrile.
| Compound Name | (E)-2-aminosulfanyl-3-[4-(dipropylamino)phenyl]prop-2-enenitrile |
|---|---|
| PubChem CID | 145041393 |
| Molecular Formula | C15H21N3S |
| Molecular Weight | 275.42 g/mol |
| Exact Mass | 275.15 |
| IUPAC Name | (E)-2-aminosulfanyl-3-[4-(dipropylamino)phenyl]prop-2-enenitrile |
| SMILES | CCCN(CCC)c1ccc(/C=C(\C#N)SN)cc1 |
| InChI | InChI=1S/C15H21N3S/c1-3-9-18(10-4-2)14-7-5-13(6-8-14)11-15(12-16)19-17/h5-8,11H,3-4,9-10,17H2,1-2H3/b15-11+ |
| InChIKey | VFDNMQKEIZYSOO-RVDMUPIBSA-N |
| XLogP | 3.78 |
| TPSA | 53.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.42 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|