C19H22N4OS — CID 7988088
(E)-2-cyano-3-[4-(dipropylamino)phenyl]-N-(1,3-thiazol-2-yl)prop-2-enamide (PubChem CID 7988088) has the molecular formula C19H22N4OS and a molecular weight of 354.48 g/mol. Its IUPAC name is (E)-2-cyano-3-[4-(dipropylamino)phenyl]-N-(1,3-thiazol-2-yl)prop-2-enamide.
| Compound Name | (E)-2-cyano-3-[4-(dipropylamino)phenyl]-N-(1,3-thiazol-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 7988088 |
| Molecular Formula | C19H22N4OS |
| Molecular Weight | 354.48 g/mol |
| Exact Mass | 354.15 |
| IUPAC Name | (E)-2-cyano-3-[4-(dipropylamino)phenyl]-N-(1,3-thiazol-2-yl)prop-2-enamide |
| SMILES | CCCN(CCC)c1ccc(/C=C(\C#N)C(=O)Nc2nccs2)cc1 |
| InChI | InChI=1S/C19H22N4OS/c1-3-10-23(11-4-2)17-7-5-15(6-8-17)13-16(14-20)18(24)22-19-21-9-12-25-19/h5-9,12-13H,3-4,10-11H2,1-2H3,(H,21,22,24)/b16-13+ |
| InChIKey | LUYQKFFBNMRSEV-DTQAZKPQSA-N |
| XLogP | 4.32 |
| TPSA | 69.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.48 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|