C16H11N3O2S — CID 48836700
(Z)-2-cyano-3-(4-prop-2-ynoxyphenyl)-N-(1,3-thiazol-2-yl)prop-2-enamide (PubChem CID 48836700) has the molecular formula C16H11N3O2S and a molecular weight of 309.35 g/mol. Its IUPAC name is (Z)-2-cyano-3-(4-prop-2-ynoxyphenyl)-N-(1,3-thiazol-2-yl)prop-2-enamide.
| Compound Name | (Z)-2-cyano-3-(4-prop-2-ynoxyphenyl)-N-(1,3-thiazol-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 48836700 |
| Molecular Formula | C16H11N3O2S |
| Molecular Weight | 309.35 g/mol |
| Exact Mass | 309.06 |
| IUPAC Name | (Z)-2-cyano-3-(4-prop-2-ynoxyphenyl)-N-(1,3-thiazol-2-yl)prop-2-enamide |
| SMILES | C#CCOc1ccc(/C=C(/C#N)C(=O)Nc2nccs2)cc1 |
| InChI | InChI=1S/C16H11N3O2S/c1-2-8-21-14-5-3-12(4-6-14)10-13(11-17)15(20)19-16-18-7-9-22-16/h1,3-7,9-10H,8H2,(H,18,19,20)/b13-10- |
| InChIKey | STFTVKCAZZGJJW-RAXLEYEMSA-N |
| XLogP | 2.70 |
| TPSA | 75.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.35 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|