C13H8N4O4S — CID 7971344
(E)-2-cyano-3-(4-hydroxy-3-nitrophenyl)-N-(1,3-thiazol-2-yl)prop-2-enamide (PubChem CID 7971344) has the molecular formula C13H8N4O4S and a molecular weight of 316.30 g/mol. Its IUPAC name is (E)-2-cyano-3-(4-hydroxy-3-nitrophenyl)-N-(1,3-thiazol-2-yl)prop-2-enamide.
| Compound Name | (E)-2-cyano-3-(4-hydroxy-3-nitrophenyl)-N-(1,3-thiazol-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 7971344 |
| Molecular Formula | C13H8N4O4S |
| Molecular Weight | 316.30 g/mol |
| Exact Mass | 316.03 |
| IUPAC Name | (E)-2-cyano-3-(4-hydroxy-3-nitrophenyl)-N-(1,3-thiazol-2-yl)prop-2-enamide |
| SMILES | N#C/C(=C\c1ccc(O)c([N+](=O)[O-])c1)C(=O)Nc1nccs1 |
| InChI | InChI=1S/C13H8N4O4S/c14-7-9(12(19)16-13-15-3-4-22-13)5-8-1-2-11(18)10(6-8)17(20)21/h1-6,18H,(H,15,16,19)/b9-5+ |
| InChIKey | IXGVRTSFLJZZJA-WEVVVXLNSA-N |
| XLogP | 2.30 |
| TPSA | 129.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.30 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|