C10H8N4O3S — CID 135570869
2-nitro-4-[(E)-(1,3-thiazol-2-ylhydrazinylidene)methyl]phenol (PubChem CID 135570869) has the molecular formula C10H8N4O3S and a molecular weight of 264.27 g/mol. Its IUPAC name is 2-nitro-4-[(E)-(1,3-thiazol-2-ylhydrazinylidene)methyl]phenol.
| Compound Name | 2-nitro-4-[(E)-(1,3-thiazol-2-ylhydrazinylidene)methyl]phenol |
|---|---|
| PubChem CID | 135570869 |
| Molecular Formula | C10H8N4O3S |
| Molecular Weight | 264.27 g/mol |
| Exact Mass | 264.03 |
| IUPAC Name | 2-nitro-4-[(E)-(1,3-thiazol-2-ylhydrazinylidene)methyl]phenol |
| SMILES | O=[N+]([O-])c1cc(/C=N/Nc2nccs2)ccc1O |
| InChI | InChI=1S/C10H8N4O3S/c15-9-2-1-7(5-8(9)14(16)17)6-12-13-10-11-3-4-18-10/h1-6,15H,(H,11,13)/b12-6+ |
| InChIKey | YVFBHCHPXSDCKT-WUXMJOGZSA-N |
| XLogP | 2.20 |
| TPSA | 100.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.27 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|