C11H11N3O2S — CID 2789383
2-methoxy-4-[(1,3-thiazol-2-ylhydrazinylidene)methyl]phenol (PubChem CID 2789383) has the molecular formula C11H11N3O2S and a molecular weight of 249.30 g/mol. Its IUPAC name is 2-methoxy-4-[(1,3-thiazol-2-ylhydrazinylidene)methyl]phenol.
| Compound Name | 2-methoxy-4-[(1,3-thiazol-2-ylhydrazinylidene)methyl]phenol |
|---|---|
| PubChem CID | 2789383 |
| Molecular Formula | C11H11N3O2S |
| Molecular Weight | 249.30 g/mol |
| Exact Mass | 249.06 |
| IUPAC Name | 2-methoxy-4-[(1,3-thiazol-2-ylhydrazinylidene)methyl]phenol |
| SMILES | COc1cc(C=NNc2nccs2)ccc1O |
| InChI | InChI=1S/C11H11N3O2S/c1-16-10-6-8(2-3-9(10)15)7-13-14-11-12-4-5-17-11/h2-7,15H,1H3,(H,12,14) |
| InChIKey | DPGFFIZIAYAZFE-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 66.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.30 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|