C11H11N3OS — CID 74253241
N-[(4-methoxyphenyl)methylideneamino]-1,3-thiazol-2-amine (PubChem CID 74253241) has the molecular formula C11H11N3OS and a molecular weight of 233.30 g/mol. Its IUPAC name is N-[(4-methoxyphenyl)methylideneamino]-1,3-thiazol-2-amine.
| Compound Name | N-[(4-methoxyphenyl)methylideneamino]-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 74253241 |
| Molecular Formula | C11H11N3OS |
| Molecular Weight | 233.30 g/mol |
| Exact Mass | 233.06 |
| IUPAC Name | N-[(4-methoxyphenyl)methylideneamino]-1,3-thiazol-2-amine |
| SMILES | COc1ccc(C=NNc2nccs2)cc1 |
| InChI | InChI=1S/C11H11N3OS/c1-15-10-4-2-9(3-5-10)8-13-14-11-12-6-7-16-11/h2-8H,1H3,(H,12,14) |
| InChIKey | OBCVRCXNAUJTCV-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 46.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.30 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|