C10H7Br2N3OS — CID 135878036
2,6-dibromo-4-[(E)-(1,3-thiazol-2-ylhydrazinylidene)methyl]phenol (PubChem CID 135878036) has the molecular formula C10H7Br2N3OS and a molecular weight of 377.06 g/mol. Its IUPAC name is 2,6-dibromo-4-[(E)-(1,3-thiazol-2-ylhydrazinylidene)methyl]phenol.
| Compound Name | 2,6-dibromo-4-[(E)-(1,3-thiazol-2-ylhydrazinylidene)methyl]phenol |
|---|---|
| PubChem CID | 135878036 |
| Molecular Formula | C10H7Br2N3OS |
| Molecular Weight | 377.06 g/mol |
| Exact Mass | 374.87 |
| IUPAC Name | 2,6-dibromo-4-[(E)-(1,3-thiazol-2-ylhydrazinylidene)methyl]phenol |
| SMILES | Oc1c(Br)cc(/C=N/Nc2nccs2)cc1Br |
| InChI | InChI=1S/C10H7Br2N3OS/c11-7-3-6(4-8(12)9(7)16)5-14-15-10-13-1-2-17-10/h1-5,16H,(H,13,15)/b14-5+ |
| InChIKey | PGAOCQBDTKINOG-LHHJGKSTSA-N |
| XLogP | 3.82 |
| TPSA | 57.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.06 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|