C10H9N3OS — CID 2789386
2-[(1,3-thiazol-2-ylhydrazinylidene)methyl]phenol (PubChem CID 2789386) has the molecular formula C10H9N3OS and a molecular weight of 219.27 g/mol. Its IUPAC name is 2-[(1,3-thiazol-2-ylhydrazinylidene)methyl]phenol.
| Compound Name | 2-[(1,3-thiazol-2-ylhydrazinylidene)methyl]phenol |
|---|---|
| PubChem CID | 2789386 |
| Molecular Formula | C10H9N3OS |
| Molecular Weight | 219.27 g/mol |
| Exact Mass | 219.05 |
| IUPAC Name | 2-[(1,3-thiazol-2-ylhydrazinylidene)methyl]phenol |
| SMILES | Oc1ccccc1C=NNc1nccs1 |
| InChI | InChI=1S/C10H9N3OS/c14-9-4-2-1-3-8(9)7-12-13-10-11-5-6-15-10/h1-7,14H,(H,11,13) |
| InChIKey | AQJOOQHNAFGZEL-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 57.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.27 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|