C10H8ClN3OS — CID 136822378
2-chloro-4-[(Z)-(1,3-thiazol-2-ylhydrazinylidene)methyl]phenol (PubChem CID 136822378) has the molecular formula C10H8ClN3OS and a molecular weight of 253.71 g/mol. Its IUPAC name is 2-chloro-4-[(Z)-(1,3-thiazol-2-ylhydrazinylidene)methyl]phenol.
| Compound Name | 2-chloro-4-[(Z)-(1,3-thiazol-2-ylhydrazinylidene)methyl]phenol |
|---|---|
| PubChem CID | 136822378 |
| Molecular Formula | C10H8ClN3OS |
| Molecular Weight | 253.71 g/mol |
| Exact Mass | 253.01 |
| IUPAC Name | 2-chloro-4-[(Z)-(1,3-thiazol-2-ylhydrazinylidene)methyl]phenol |
| SMILES | Oc1ccc(/C=N\Nc2nccs2)cc1Cl |
| InChI | InChI=1S/C10H8ClN3OS/c11-8-5-7(1-2-9(8)15)6-13-14-10-12-3-4-16-10/h1-6,15H,(H,12,14)/b13-6- |
| InChIKey | FMMJCHYFTHMQCQ-MLPAPPSSSA-N |
| XLogP | 2.95 |
| TPSA | 57.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.71 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|