C14H9Cl2N3S2 — CID 110535518
N-[(Z)-(3,4-dichlorophenyl)methylideneamino]-4-thiophen-2-yl-1,3-thiazol-2-amine (PubChem CID 110535518) has the molecular formula C14H9Cl2N3S2 and a molecular weight of 354.29 g/mol. Its IUPAC name is N-[(Z)-(3,4-dichlorophenyl)methylideneamino]-4-thiophen-2-yl-1,3-thiazol-2-amine.
| Compound Name | N-[(Z)-(3,4-dichlorophenyl)methylideneamino]-4-thiophen-2-yl-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 110535518 |
| Molecular Formula | C14H9Cl2N3S2 |
| Molecular Weight | 354.29 g/mol |
| Exact Mass | 352.96 |
| IUPAC Name | N-[(Z)-(3,4-dichlorophenyl)methylideneamino]-4-thiophen-2-yl-1,3-thiazol-2-amine |
| SMILES | Clc1ccc(/C=N\Nc2nc(-c3cccs3)cs2)cc1Cl |
| InChI | InChI=1S/C14H9Cl2N3S2/c15-10-4-3-9(6-11(10)16)7-17-19-14-18-12(8-21-14)13-2-1-5-20-13/h1-8H,(H,18,19)/b17-7- |
| InChIKey | UVXSKOREIZDBON-IDUWFGFVSA-N |
| XLogP | 5.62 |
| TPSA | 37.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.29 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|