C20H13Cl2N3S — CID 135391679
4-(3,4-dichlorophenyl)-N-[(E)-naphthalen-2-ylmethylideneamino]-1,3-thiazol-2-amine (PubChem CID 135391679) has the molecular formula C20H13Cl2N3S and a molecular weight of 398.32 g/mol. Its IUPAC name is 4-(3,4-dichlorophenyl)-N-[(E)-naphthalen-2-ylmethylideneamino]-1,3-thiazol-2-amine.
| Compound Name | 4-(3,4-dichlorophenyl)-N-[(E)-naphthalen-2-ylmethylideneamino]-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 135391679 |
| Molecular Formula | C20H13Cl2N3S |
| Molecular Weight | 398.32 g/mol |
| Exact Mass | 397.02 |
| IUPAC Name | 4-(3,4-dichlorophenyl)-N-[(E)-naphthalen-2-ylmethylideneamino]-1,3-thiazol-2-amine |
| SMILES | Clc1ccc(-c2csc(N/N=C/c3ccc4ccccc4c3)n2)cc1Cl |
| InChI | InChI=1S/C20H13Cl2N3S/c21-17-8-7-16(10-18(17)22)19-12-26-20(24-19)25-23-11-13-5-6-14-3-1-2-4-15(14)9-13/h1-12H,(H,24,25)/b23-11+ |
| InChIKey | RIIHTJAGFINNDM-FOKLQQMPSA-N |
| XLogP | 6.72 |
| TPSA | 37.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.32 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|