C18H16Cl2N4S — CID 21240106
4-(3,4-dichlorophenyl)-N-[(E)-[4-(dimethylamino)phenyl]methylideneamino]-1,3-thiazol-2-amine (PubChem CID 21240106) has the molecular formula C18H16Cl2N4S and a molecular weight of 391.33 g/mol. Its IUPAC name is 4-(3,4-dichlorophenyl)-N-[(E)-[4-(dimethylamino)phenyl]methylideneamino]-1,3-thiazol-2-amine.
| Compound Name | 4-(3,4-dichlorophenyl)-N-[(E)-[4-(dimethylamino)phenyl]methylideneamino]-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 21240106 |
| Molecular Formula | C18H16Cl2N4S |
| Molecular Weight | 391.33 g/mol |
| Exact Mass | 390.05 |
| IUPAC Name | 4-(3,4-dichlorophenyl)-N-[(E)-[4-(dimethylamino)phenyl]methylideneamino]-1,3-thiazol-2-amine |
| SMILES | CN(C)c1ccc(/C=N/Nc2nc(-c3ccc(Cl)c(Cl)c3)cs2)cc1 |
| InChI | InChI=1S/C18H16Cl2N4S/c1-24(2)14-6-3-12(4-7-14)10-21-23-18-22-17(11-25-18)13-5-8-15(19)16(20)9-13/h3-11H,1-2H3,(H,22,23)/b21-10+ |
| InChIKey | IVCDUHFWORNTHD-UFFVCSGVSA-N |
| XLogP | 5.63 |
| TPSA | 40.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.33 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_anil_di_alk(35)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|