C25H23N5OS — CID 6229470
N-[4-[2-[(2Z)-2-[[4-(dimethylamino)phenyl]methylidene]hydrazinyl]-1,3-thiazol-4-yl]phenyl]benzamide (PubChem CID 6229470) has the molecular formula C25H23N5OS and a molecular weight of 441.56 g/mol. Its IUPAC name is N-[4-[2-[(2Z)-2-[[4-(dimethylamino)phenyl]methylidene]hydrazinyl]-1,3-thiazol-4-yl]phenyl]benzamide.
| Compound Name | N-[4-[2-[(2Z)-2-[[4-(dimethylamino)phenyl]methylidene]hydrazinyl]-1,3-thiazol-4-yl]phenyl]benzamide |
|---|---|
| PubChem CID | 6229470 |
| Molecular Formula | C25H23N5OS |
| Molecular Weight | 441.56 g/mol |
| Exact Mass | 441.16 |
| IUPAC Name | N-[4-[2-[(2Z)-2-[[4-(dimethylamino)phenyl]methylidene]hydrazinyl]-1,3-thiazol-4-yl]phenyl]benzamide |
| SMILES | CN(C)c1ccc(/C=N\Nc2nc(-c3ccc(NC(=O)c4ccccc4)cc3)cs2)cc1 |
| InChI | InChI=1S/C25H23N5OS/c1-30(2)22-14-8-18(9-15-22)16-26-29-25-28-23(17-32-25)19-10-12-21(13-11-19)27-24(31)20-6-4-3-5-7-20/h3-17H,1-2H3,(H,27,31)(H,28,29)/b26-16- |
| InChIKey | CKFUKTAKBTZJTA-QQXSKIMKSA-N |
| XLogP | 5.57 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.56 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_anil_di_alk(35)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|