C36H33N5O3S2 — CID 22191969
N-[(Z)-1-[4-(dimethylamino)phenyl]-3-[4-[2-[[4-(4-methylphenyl)-1,3-thiazol-2-yl]amino]-2-oxoethyl]sulfanylanilino]-3-oxoprop-1-en-2-yl]benzamide (PubChem CID 22191969) has the molecular formula C36H33N5O3S2 and a molecular weight of 647.83 g/mol. Its IUPAC name is N-[(Z)-1-[4-(dimethylamino)phenyl]-3-[4-[2-[[4-(4-methylphenyl)-1,3-thiazol-2-yl]amino]-2-oxoethyl]sulfanylanilino]-3-oxoprop-1-en-2-yl]benzamide.
| Compound Name | N-[(Z)-1-[4-(dimethylamino)phenyl]-3-[4-[2-[[4-(4-methylphenyl)-1,3-thiazol-2-yl]amino]-2-oxoethyl]sulfanylanilino]-3-oxoprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 22191969 |
| Molecular Formula | C36H33N5O3S2 |
| Molecular Weight | 647.83 g/mol |
| Exact Mass | 647.20 |
| IUPAC Name | N-[(Z)-1-[4-(dimethylamino)phenyl]-3-[4-[2-[[4-(4-methylphenyl)-1,3-thiazol-2-yl]amino]-2-oxoethyl]sulfanylanilino]-3-oxoprop-1-en-2-yl]benzamide |
| SMILES | Cc1ccc(-c2csc(NC(=O)CSc3ccc(NC(=O)/C(=C/c4ccc(N(C)C)cc4)NC(=O)c4ccccc4)cc3)n2)cc1 |
| InChI | InChI=1S/C36H33N5O3S2/c1-24-9-13-26(14-10-24)32-22-46-36(39-32)40-33(42)23-45-30-19-15-28(16-20-30)37-35(44)31(38-34(43)27-7-5-4-6-8-27)21-25-11-17-29(18-12-25)41(2)3/h4-22H,23H2,1-3H3,(H,37,44)(H,38,43)(H,39,40,42)/b31-21- |
| InChIKey | OKLSKPUNZGSWTO-YQYKVWLJSA-N |
| XLogP | 7.32 |
| TPSA | 103.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.83 |
| LogP ≤ 5 | 7.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|