C23H22N4S2 — CID 110531341
N-[(Z)-[4-[benzyl(ethyl)amino]phenyl]methylideneamino]-4-thiophen-2-yl-1,3-thiazol-2-amine (PubChem CID 110531341) has the molecular formula C23H22N4S2 and a molecular weight of 418.59 g/mol. Its IUPAC name is N-[(Z)-[4-[benzyl(ethyl)amino]phenyl]methylideneamino]-4-thiophen-2-yl-1,3-thiazol-2-amine.
| Compound Name | N-[(Z)-[4-[benzyl(ethyl)amino]phenyl]methylideneamino]-4-thiophen-2-yl-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 110531341 |
| Molecular Formula | C23H22N4S2 |
| Molecular Weight | 418.59 g/mol |
| Exact Mass | 418.13 |
| IUPAC Name | N-[(Z)-[4-[benzyl(ethyl)amino]phenyl]methylideneamino]-4-thiophen-2-yl-1,3-thiazol-2-amine |
| SMILES | CCN(Cc1ccccc1)c1ccc(/C=N\Nc2nc(-c3cccs3)cs2)cc1 |
| InChI | InChI=1S/C23H22N4S2/c1-2-27(16-19-7-4-3-5-8-19)20-12-10-18(11-13-20)15-24-26-23-25-21(17-29-23)22-9-6-14-28-22/h3-15,17H,2,16H2,1H3,(H,25,26)/b24-15- |
| InChIKey | RZHSNTQDLPDMPP-IWIPYMOSSA-N |
| XLogP | 6.34 |
| TPSA | 40.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.59 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_anil_di_alk(35)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|