C13H10N4S2 — CID 110539249
N-[(Z)-pyridin-4-ylmethylideneamino]-4-thiophen-2-yl-1,3-thiazol-2-amine (PubChem CID 110539249) has the molecular formula C13H10N4S2 and a molecular weight of 286.39 g/mol. Its IUPAC name is N-[(Z)-pyridin-4-ylmethylideneamino]-4-thiophen-2-yl-1,3-thiazol-2-amine.
| Compound Name | N-[(Z)-pyridin-4-ylmethylideneamino]-4-thiophen-2-yl-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 110539249 |
| Molecular Formula | C13H10N4S2 |
| Molecular Weight | 286.39 g/mol |
| Exact Mass | 286.03 |
| IUPAC Name | N-[(Z)-pyridin-4-ylmethylideneamino]-4-thiophen-2-yl-1,3-thiazol-2-amine |
| SMILES | C(=N\Nc1nc(-c2cccs2)cs1)\c1ccncc1 |
| InChI | InChI=1S/C13H10N4S2/c1-2-12(18-7-1)11-9-19-13(16-11)17-15-8-10-3-5-14-6-4-10/h1-9H,(H,16,17)/b15-8- |
| InChIKey | PWGXDIWCAXYWKL-NVNXTCNLSA-N |
| XLogP | 3.71 |
| TPSA | 50.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.39 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|